C32H56O3Si2 — CID 11827700
trans-(3R,4R)-3-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-pentylphenyl]-4-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 11827700) has the molecular formula C32H56O3Si2 and a molecular weight of 544.97 g/mol. Its IUPAC name is trans-(3R,4R)-3-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-pentylphenyl]-4-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | trans-(3R,4R)-3-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-pentylphenyl]-4-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 11827700 |
| Molecular Formula | C32H56O3Si2 |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | trans-(3R,4R)-3-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-pentylphenyl]-4-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@@H]1CCC(=O)C[C@H]1c1c(O[Si](C)(C)C(C)(C)C)cc(CCCCC)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H56O3Si2/c1-14-15-16-17-24-20-28(34-36(10,11)31(4,5)6)30(27-22-25(33)18-19-26(27)23(2)3)29(21-24)35-37(12,13)32(7,8)9/h20-21,26-27H,2,14-19,22H2,1,3-13H3/t26-,27+/m0/s1 |
| InChIKey | ZOKJWXRSUCXNAL-RRPNLBNLSA-N |
| XLogP | 10.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|