C16H19F2N5O — CID 118277711
(9R,13S)-13-amino-3-(difluoromethyl)-9-methyl-3,4,7,17-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one (PubChem CID 118277711) has the molecular formula C16H19F2N5O and a molecular weight of 335.36 g/mol. Its IUPAC name is (9R,13S)-13-amino-3-(difluoromethyl)-9-methyl-3,4,7,17-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one.
| Compound Name | (9R,13S)-13-amino-3-(difluoromethyl)-9-methyl-3,4,7,17-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one |
|---|---|
| PubChem CID | 118277711 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (9R,13S)-13-amino-3-(difluoromethyl)-9-methyl-3,4,7,17-tetrazatricyclo[12.3.1.02,6]octadeca-1(17),2(6),4,14(18),15-pentaen-8-one |
| SMILES | C[C@@H]1CCC[C@H](N)c2ccnc(c2)-c2c(cnn2C(F)F)NC1=O |
| InChI | InChI=1S/C16H19F2N5O/c1-9-3-2-4-11(19)10-5-6-20-12(7-10)14-13(22-15(9)24)8-21-23(14)16(17)18/h5-9,11,16H,2-4,19H2,1H3,(H,22,24)/t9-,11+/m1/s1 |
| InChIKey | ORHGQGWEIAFZEC-KOLCDFICSA-N |
| XLogP | 3.10 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |