C17H22N4O — CID 118277743
(9R,13S)-13-amino-3,9-dimethyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 118277743) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is (9R,13S)-13-amino-3,9-dimethyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | (9R,13S)-13-amino-3,9-dimethyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 118277743 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (9R,13S)-13-amino-3,9-dimethyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | C[C@@H]1CCC[C@H](N)c2cccc(c2)-c2c(cnn2C)NC1=O |
| InChI | InChI=1S/C17H22N4O/c1-11-5-3-8-14(18)12-6-4-7-13(9-12)16-15(20-17(11)22)10-19-21(16)2/h4,6-7,9-11,14H,3,5,8,18H2,1-2H3,(H,20,22)/t11-,14+/m1/s1 |
| InChIKey | AVYYDCRCBDXWSZ-RISCZKNCSA-N |
| XLogP | 2.85 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |