About 3-fluoro-1,2-dihydroindol-3-ol
3-fluoro-1,2-dihydroindol-3-ol (PubChem CID 118277781) has the molecular formula C8H8FNO
and a molecular weight of 153.16 g/mol. Its IUPAC name is 3-fluoro-1,2-dihydroindol-3-ol.
Molecular Properties
| Compound Name | 3-fluoro-1,2-dihydroindol-3-ol |
| PubChem CID | 118277781 |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 3-fluoro-1,2-dihydroindol-3-ol |
| SMILES | OC1(F)CNc2ccccc21 |
| InChI | InChI=1S/C8H8FNO/c9-8(11)5-10-7-4-2-1-3-6(7)8/h1-4,10-11H,5H2 |
| InChIKey | XUFUPLHFKYXMSY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-1,2-dihydroindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,2-dihydroindol-3-ol?
The IUPAC name of 3-fluoro-1,2-dihydroindol-3-ol (CID 118277781) is 3-fluoro-1,2-dihydroindol-3-ol.
What is the SMILES notation for 3-fluoro-1,2-dihydroindol-3-ol?
The canonical SMILES for 3-fluoro-1,2-dihydroindol-3-ol is OC1(F)CNc2ccccc21.
What is the InChIKey of 3-fluoro-1,2-dihydroindol-3-ol?
The InChIKey is XUFUPLHFKYXMSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO/c9-8(11)5-10-7-4-2-1-3-6(7)8/h1-4,10-11H,5H2.
What are the key properties of 3-fluoro-1,2-dihydroindol-3-ol?
3-fluoro-1,2-dihydroindol-3-ol has a molecular weight of 153.16 g/mol, XLogP of 1.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,2-dihydroindol-3-ol is sourced from PubChem (CID 118277781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).