About 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline
4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline (PubChem CID 11827782) has the molecular formula C39H28N4
and a molecular weight of 552.68 g/mol. Its IUPAC name is 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline.
Molecular Properties
| Compound Name | 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline |
| PubChem CID | 11827782 |
| Molecular Formula | C39H28N4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H28N4/c1-3-11-33(12-4-1)43(34-13-5-2-6-14-34)35-23-21-30(22-24-35)29-17-19-31(20-18-29)32-27-38(36-15-7-9-25-40-36)42-39(28-32)37-16-8-10-26-41-37/h1-28H |
| InChIKey | HAEIIMDPEDYNBM-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline?
The IUPAC name of 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline (CID 11827782) is 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline.
What is the SMILES notation for 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline?
The canonical SMILES for 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline is c1ccc(N(c2ccccc2)c2ccc(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)cc2)cc1.
What is the InChIKey of 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline?
The InChIKey is HAEIIMDPEDYNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H28N4/c1-3-11-33(12-4-1)43(34-13-5-2-6-14-34)35-23-21-30(22-24-35)29-17-19-31(20-18-29)32-27-38(36-15-7-9-25-40-36)42-39(28-32)37-16-8-10-26-41-37/h1-28H.
What are the key properties of 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline?
4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline has a molecular weight of 552.68 g/mol, XLogP of 10.01, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]-N,N-diphenylaniline is sourced from PubChem (CID 11827782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).