C34H52O6 — CID 11827807
[(1S,4S,5R,8R,10S,13R,14R,16S,17S,18R)-16-acetyloxy-4,5,9,9,13,20,20-heptamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] acetate (PubChem CID 11827807) has the molecular formula C34H52O6 and a molecular weight of 556.78 g/mol. Its IUPAC name is [(1S,4S,5R,8R,10S,13R,14R,16S,17S,18R)-16-acetyloxy-4,5,9,9,13,20,20-heptamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] acetate.
| Compound Name | [(1S,4S,5R,8R,10S,13R,14R,16S,17S,18R)-16-acetyloxy-4,5,9,9,13,20,20-heptamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] acetate |
|---|---|
| PubChem CID | 11827807 |
| Molecular Formula | C34H52O6 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | [(1S,4S,5R,8R,10S,13R,14R,16S,17S,18R)-16-acetyloxy-4,5,9,9,13,20,20-heptamethyl-23-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosan-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H]3C[C@H](OC(C)=O)[C@]45OC(=O)[C@@]6(CCC(C)(C)C[C@H]64)CC[C@@]5(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C34H52O6/c1-20(35)38-25-11-12-30(7)22(29(25,5)6)10-13-31(8)23(30)18-26(39-21(2)36)34-24-19-28(3,4)14-16-33(24,27(37)40-34)17-15-32(31,34)9/h22-26H,10-19H2,1-9H3/t22-,23+,24+,25-,26-,30-,31+,32-,33-,34+/m0/s1 |
| InChIKey | PHYDMGIRKRRCER-HFTPXWKKSA-N |
| XLogP | 7.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|