About methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate
methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate (PubChem CID 118278250) has the molecular formula C20H15Cl2FN2O4
and a molecular weight of 437.25 g/mol. Its IUPAC name is methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate |
| PubChem CID | 118278250 |
| Molecular Formula | C20H15Cl2FN2O4 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate |
| SMILES | COC(=O)c1cnccc1-c1ccc(Cl)cc1F.COC(=O)c1cnccc1Cl |
| InChI | InChI=1S/C13H9ClFNO2.C7H6ClNO2/c1-18-13(17)11-7-16-5-4-9(11)10-3-2-8(14)6-12(10)15;1-11-7(10)5-4-9-3-2-6(5)8/h2-7H,1H3;2-4H,1H3 |
| InChIKey | TVYIWWPHTKGXRU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate?
The IUPAC name of methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate (CID 118278250) is methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate.
What is the SMILES notation for methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate?
The canonical SMILES for methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate is COC(=O)c1cnccc1-c1ccc(Cl)cc1F.COC(=O)c1cnccc1Cl.
What is the InChIKey of methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate?
The InChIKey is TVYIWWPHTKGXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClFNO2.C7H6ClNO2/c1-18-13(17)11-7-16-5-4-9(11)10-3-2-8(14)6-12(10)15;1-11-7(10)5-4-9-3-2-6(5)8/h2-7H,1H3;2-4H,1H3.
What are the key properties of methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate?
methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate has a molecular weight of 437.25 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-chloro-2-fluorophenyl)pyridine-3-carboxylate;methyl 4-chloropyridine-3-carboxylate is sourced from PubChem (CID 118278250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).