C20H28N2O — CID 118278291
4,6-dimethyl-8-(4-methylpentoxy)-5,6a-dihydro-3H-benzo[c][2,7]naphthyridine (PubChem CID 118278291) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 4,6-dimethyl-8-(4-methylpentoxy)-5,6a-dihydro-3H-benzo[c][2,7]naphthyridine.
| Compound Name | 4,6-dimethyl-8-(4-methylpentoxy)-5,6a-dihydro-3H-benzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 118278291 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4,6-dimethyl-8-(4-methylpentoxy)-5,6a-dihydro-3H-benzo[c][2,7]naphthyridine |
| SMILES | CC1=C2CN(C)C3C=C(OCCCC(C)C)C=CC3=C2C=CN1 |
| InChI | InChI=1S/C20H28N2O/c1-14(2)6-5-11-23-16-7-8-18-17-9-10-21-15(3)19(17)13-22(4)20(18)12-16/h7-10,12,14,20-21H,5-6,11,13H2,1-4H3 |
| InChIKey | KNHJWAXIKDYJJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|