About 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one
7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 118278506) has the molecular formula C7H5ClN2O2
and a molecular weight of 184.58 g/mol. Its IUPAC name is 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one |
| PubChem CID | 118278506 |
| Molecular Formula | C7H5ClN2O2 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2cc(Cl)ncc2N1 |
| InChI | InChI=1S/C7H5ClN2O2/c8-6-1-5-4(2-9-6)10-7(11)3-12-5/h1-2H,3H2,(H,10,11) |
| InChIKey | XSXCAGMINNETDK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one?
The IUPAC name of 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one (CID 118278506) is 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one.
What is the SMILES notation for 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one?
The canonical SMILES for 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one is O=C1COc2cc(Cl)ncc2N1.
What is the InChIKey of 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one?
The InChIKey is XSXCAGMINNETDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O2/c8-6-1-5-4(2-9-6)10-7(11)3-12-5/h1-2H,3H2,(H,10,11).
What are the key properties of 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one?
7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one has a molecular weight of 184.58 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4H-pyrido[4,3-b][1,4]oxazin-3-one is sourced from PubChem (CID 118278506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).