C18H19NO5 — CID 118279142
9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 118279142) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 118279142 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COCCCOc1ccc2c(c1)CCn1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C18H19NO5/c1-23-7-2-8-24-13-3-4-14-12(9-13)5-6-19-11-15(18(21)22)17(20)10-16(14)19/h3-4,9-11H,2,5-8H2,1H3,(H,21,22) |
| InChIKey | YKIUFITWVFKZJP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|