C28H53NO7Si2 — CID 11827926
tert-butyl (1S,2R,3R,7R,8S,9R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecane-10-carboxylate (PubChem CID 11827926) has the molecular formula C28H53NO7Si2 and a molecular weight of 571.90 g/mol. Its IUPAC name is tert-butyl (1S,2R,3R,7R,8S,9R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecane-10-carboxylate.
| Compound Name | tert-butyl (1S,2R,3R,7R,8S,9R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecane-10-carboxylate |
|---|---|
| PubChem CID | 11827926 |
| Molecular Formula | C28H53NO7Si2 |
| Molecular Weight | 571.90 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | tert-butyl (1S,2R,3R,7R,8S,9R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecane-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H]2C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H53NO7Si2/c1-25(2,3)34-24(31)29-18-16-17(23(29)30)19(35-37(12,13)26(4,5)6)21-22(33-28(10,11)32-21)20(18)36-38(14,15)27(7,8)9/h17-22H,16H2,1-15H3/t17-,18+,19+,20-,21-,22-/m0/s1 |
| InChIKey | VGCLVDZGTWYXRR-ZCPXKWAGSA-N |
| XLogP | 6.45 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.90 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|