C27H22F6O7 — CID 11827929
[(1R,2R,3S,4R)-2,4-diacetyloxy-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl] acetate (PubChem CID 11827929) has the molecular formula C27H22F6O7 and a molecular weight of 572.45 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,4-diacetyloxy-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl] acetate.
| Compound Name | [(1R,2R,3S,4R)-2,4-diacetyloxy-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11827929 |
| Molecular Formula | C27H22F6O7 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | [(1R,2R,3S,4R)-2,4-diacetyloxy-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,2,3,4-tetrahydrobenzo[g]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](OC(C(F)(F)F)C(F)(F)F)c2c(ccc3ccc4ccccc4c23)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H22F6O7/c1-12(34)37-21-18-11-10-16-9-8-15-6-4-5-7-17(15)19(16)20(18)22(40-25(26(28,29)30)27(31,32)33)24(39-14(3)36)23(21)38-13(2)35/h4-11,21-25H,1-3H3/t21-,22-,23+,24-/m1/s1 |
| InChIKey | ODTYGSOYBREILH-JLLPCOHGSA-N |
| XLogP | 6.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|