C20H26BrNO6 — CID 118279756
butyl N-[(2S)-1-(4-bromophenyl)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate (PubChem CID 118279756) has the molecular formula C20H26BrNO6 and a molecular weight of 456.33 g/mol. Its IUPAC name is butyl N-[(2S)-1-(4-bromophenyl)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate.
| Compound Name | butyl N-[(2S)-1-(4-bromophenyl)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 118279756 |
| Molecular Formula | C20H26BrNO6 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | butyl N-[(2S)-1-(4-bromophenyl)-3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@H](Cc1ccc(Br)cc1)CC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C20H26BrNO6/c1-4-5-10-26-19(25)22-15(11-13-6-8-14(21)9-7-13)12-16-17(23)27-20(2,3)28-18(16)24/h6-9,15-16H,4-5,10-12H2,1-3H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | ZAQWUXFOHQWVFT-OAHLLOKOSA-N |
| XLogP | 3.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|