About 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide
3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide (PubChem CID 118280388) has the molecular formula C17H21BrN4OS
and a molecular weight of 409.35 g/mol. Its IUPAC name is 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide.
Molecular Properties
| Compound Name | 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide |
| PubChem CID | 118280388 |
| Molecular Formula | C17H21BrN4OS |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide |
| SMILES | CCc1cc2c(=O)n(CC[n+]3ccc(N(C)C)cc3)cnc2s1.[Br-] |
| InChI | InChI=1S/C17H21N4OS.BrH/c1-4-14-11-15-16(23-14)18-12-21(17(15)22)10-9-20-7-5-13(6-8-20)19(2)3;/h5-8,11-12H,4,9-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DKPZVFCANQCAFO-UHFFFAOYSA-M |
| XLogP | -0.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide?
The IUPAC name of 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide (CID 118280388) is 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide.
What is the SMILES notation for 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide?
The canonical SMILES for 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide is CCc1cc2c(=O)n(CC[n+]3ccc(N(C)C)cc3)cnc2s1.[Br-].
What is the InChIKey of 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide?
The InChIKey is DKPZVFCANQCAFO-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H21N4OS.BrH/c1-4-14-11-15-16(23-14)18-12-21(17(15)22)10-9-20-7-5-13(6-8-20)19(2)3;/h5-8,11-12H,4,9-10H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide?
3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide has a molecular weight of 409.35 g/mol, XLogP of -0.92, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[4-(dimethylamino)pyridin-1-ium-1-yl]ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one bromide is sourced from PubChem (CID 118280388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).