C31H34ClFN2O6 — CID 118280449
benzyl (2R,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[ethoxycarbonyl(2-methylpropanoyloxy)amino]pentanoate (PubChem CID 118280449) has the molecular formula C31H34ClFN2O6 and a molecular weight of 585.07 g/mol. Its IUPAC name is benzyl (2R,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[ethoxycarbonyl(2-methylpropanoyloxy)amino]pentanoate.
| Compound Name | benzyl (2R,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[ethoxycarbonyl(2-methylpropanoyloxy)amino]pentanoate |
|---|---|
| PubChem CID | 118280449 |
| Molecular Formula | C31H34ClFN2O6 |
| Molecular Weight | 585.07 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | benzyl (2R,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-[ethoxycarbonyl(2-methylpropanoyloxy)amino]pentanoate |
| SMILES | CCOC(=O)N(OC(=O)C(C)C)[C@H](C[C@H](N)Cc1ccc(-c2cc(Cl)ccc2F)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H34ClFN2O6/c1-4-39-31(38)35(41-29(36)20(2)3)28(30(37)40-19-22-8-6-5-7-9-22)18-25(34)16-21-10-12-23(13-11-21)26-17-24(32)14-15-27(26)33/h5-15,17,20,25,28H,4,16,18-19,34H2,1-3H3/t25-,28-/m1/s1 |
| InChIKey | RFHPTGFRDKVBMR-LEAFIULHSA-N |
| XLogP | 6.09 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.07 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|