C34H37NO2S — CID 11828051
2-[(4S,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylethanethiol (PubChem CID 11828051) has the molecular formula C34H37NO2S and a molecular weight of 523.74 g/mol. Its IUPAC name is 2-[(4S,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylethanethiol.
| Compound Name | 2-[(4S,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylethanethiol |
|---|---|
| PubChem CID | 11828051 |
| Molecular Formula | C34H37NO2S |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | 2-[(4S,5S)-5-[dimethylamino(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-diphenylethanethiol |
| SMILES | CN(C)C(c1ccccc1)(c1ccccc1)[C@@H]1OC(C)(C)O[C@H]1C(CS)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37NO2S/c1-32(2)36-30(33(25-38,26-17-9-5-10-18-26)27-19-11-6-12-20-27)31(37-32)34(35(3)4,28-21-13-7-14-22-28)29-23-15-8-16-24-29/h5-24,30-31,38H,25H2,1-4H3/t30-,31-/m1/s1 |
| InChIKey | PTCBABSKZRJCON-FIRIVFDPSA-N |
| XLogP | 6.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|