About piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate
piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate (PubChem CID 118280653) has the molecular formula C15H21F2NO3S
and a molecular weight of 333.40 g/mol. Its IUPAC name is piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate.
Molecular Properties
| Compound Name | piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate |
| PubChem CID | 118280653 |
| Molecular Formula | C15H21F2NO3S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate |
| SMILES | O=S(=O)(C[C@H](CC(F)F)c1ccccc1)OC1CCNCC1 |
| InChI | InChI=1S/C15H21F2NO3S/c16-15(17)10-13(12-4-2-1-3-5-12)11-22(19,20)21-14-6-8-18-9-7-14/h1-5,13-15,18H,6-11H2/t13-/m0/s1 |
| InChIKey | TXYWJQKBNVCURE-ZDUSSCGKSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate?
The IUPAC name of piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate (CID 118280653) is piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate.
What is the SMILES notation for piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate?
The canonical SMILES for piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate is O=S(=O)(C[C@H](CC(F)F)c1ccccc1)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate?
The InChIKey is TXYWJQKBNVCURE-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H21F2NO3S/c16-15(17)10-13(12-4-2-1-3-5-12)11-22(19,20)21-14-6-8-18-9-7-14/h1-5,13-15,18H,6-11H2/t13-/m0/s1.
What are the key properties of piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate?
piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate has a molecular weight of 333.40 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl (2R)-4,4-difluoro-2-phenylbutane-1-sulfonate is sourced from PubChem (CID 118280653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).