C23H23N7O3S2 — CID 118280721
1-ethyl-1-[7-(5-methyl-2-pyridinyl)-5-[2-(prop-2-enylsulfonylamino)pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea (PubChem CID 118280721) has the molecular formula C23H23N7O3S2 and a molecular weight of 509.62 g/mol. Its IUPAC name is 1-ethyl-1-[7-(5-methyl-2-pyridinyl)-5-[2-(prop-2-enylsulfonylamino)pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-ethyl-1-[7-(5-methyl-2-pyridinyl)-5-[2-(prop-2-enylsulfonylamino)pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 118280721 |
| Molecular Formula | C23H23N7O3S2 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-ethyl-1-[7-(5-methyl-2-pyridinyl)-5-[2-(prop-2-enylsulfonylamino)pyrimidin-5-yl]-1,3-benzothiazol-2-yl]urea |
| SMILES | C=CCS(=O)(=O)Nc1ncc(-c2cc(-c3ccc(C)cn3)c3sc(N(CC)C(N)=O)nc3c2)cn1 |
| InChI | InChI=1S/C23H23N7O3S2/c1-4-8-35(32,33)29-22-26-12-16(13-27-22)15-9-17(18-7-6-14(3)11-25-18)20-19(10-15)28-23(34-20)30(5-2)21(24)31/h4,6-7,9-13H,1,5,8H2,2-3H3,(H2,24,31)(H,26,27,29) |
| InChIKey | WPTTZBFPAWAJFW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 144.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|