C22H22N6O — CID 118280903
2-methyl-5-[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-1,3-benzoxazole (PubChem CID 118280903) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-methyl-5-[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-1,3-benzoxazole.
| Compound Name | 2-methyl-5-[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 118280903 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-methyl-5-[3-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)pyrido[2,3-b]pyrazin-6-yl]-1,3-benzoxazole |
| SMILES | Cc1nc2cc(-c3ccc4ncc(N5CC6CN(C)CC6C5)nc4n3)ccc2o1 |
| InChI | InChI=1S/C22H22N6O/c1-13-24-19-7-14(3-6-20(19)29-13)17-4-5-18-22(25-17)26-21(8-23-18)28-11-15-9-27(2)10-16(15)12-28/h3-8,15-16H,9-12H2,1-2H3 |
| InChIKey | DMWORVURKIRVKL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |