About ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate
ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate (PubChem CID 118281318) has the molecular formula C17H30O5
and a molecular weight of 314.42 g/mol. Its IUPAC name is ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate.
Molecular Properties
| Compound Name | ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate |
| PubChem CID | 118281318 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate |
| SMILES | C=C1C[C@H](C[C@@H](O)CC(=O)OCC)O[C@H](C[C@@H](C)CCO)C1 |
| InChI | InChI=1S/C17H30O5/c1-4-21-17(20)11-14(19)10-16-9-13(3)8-15(22-16)7-12(2)5-6-18/h12,14-16,18-19H,3-11H2,1-2H3/t12-,14+,15+,16+/m0/s1 |
| InChIKey | PEZANCSYDQOBIF-LCGIIJARSA-N |
| XLogP | 2.20 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate?
The IUPAC name of ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate (CID 118281318) is ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate.
What is the SMILES notation for ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate?
The canonical SMILES for ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate is C=C1C[C@H](C[C@@H](O)CC(=O)OCC)O[C@H](C[C@@H](C)CCO)C1.
What is the InChIKey of ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate?
The InChIKey is PEZANCSYDQOBIF-LCGIIJARSA-N. The full InChI is InChI=1S/C17H30O5/c1-4-21-17(20)11-14(19)10-16-9-13(3)8-15(22-16)7-12(2)5-6-18/h12,14-16,18-19H,3-11H2,1-2H3/t12-,14+,15+,16+/m0/s1.
What are the key properties of ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate?
ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate has a molecular weight of 314.42 g/mol, XLogP of 2.20, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-hydroxy-4-[(2R,6R)-6-[(2S)-4-hydroxy-2-methylbutyl]-4-methylideneoxan-2-yl]butanoate is sourced from PubChem (CID 118281318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).