About 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one
4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one (PubChem CID 118281406) has the molecular formula C25H46O6
and a molecular weight of 442.64 g/mol. Its IUPAC name is 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one |
| PubChem CID | 118281406 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one |
| SMILES | CCCCCC1CC(=O)C(C2OC(COC)C(OC)C(OC)C2OC)CC1CCCC |
| InChI | InChI=1S/C25H46O6/c1-7-9-11-13-18-15-20(26)19(14-17(18)12-10-8-2)22-24(29-5)25(30-6)23(28-4)21(31-22)16-27-3/h17-19,21-25H,7-16H2,1-6H3 |
| InChIKey | YMAQXECILVGGEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one?
The IUPAC name of 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one (CID 118281406) is 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one.
What is the SMILES notation for 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one?
The canonical SMILES for 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one is CCCCCC1CC(=O)C(C2OC(COC)C(OC)C(OC)C2OC)CC1CCCC.
What is the InChIKey of 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one?
The InChIKey is YMAQXECILVGGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46O6/c1-7-9-11-13-18-15-20(26)19(14-17(18)12-10-8-2)22-24(29-5)25(30-6)23(28-4)21(31-22)16-27-3/h17-19,21-25H,7-16H2,1-6H3.
What are the key properties of 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one?
4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one has a molecular weight of 442.64 g/mol, XLogP of 4.43, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-pentyl-2-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]cyclohexan-1-one is sourced from PubChem (CID 118281406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).