About 3-methyl-2,7a-dihydro-1H-indazole
3-methyl-2,7a-dihydro-1H-indazole (PubChem CID 118281576) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3-methyl-2,7a-dihydro-1H-indazole.
Molecular Properties
| Compound Name | 3-methyl-2,7a-dihydro-1H-indazole |
| PubChem CID | 118281576 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3-methyl-2,7a-dihydro-1H-indazole |
| SMILES | CC1=C2C=CC=CC2NN1 |
| InChI | InChI=1S/C8H10N2/c1-6-7-4-2-3-5-8(7)10-9-6/h2-5,8-10H,1H3 |
| InChIKey | SQGGYZIHCWPFIX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2,7a-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,7a-dihydro-1H-indazole?
The IUPAC name of 3-methyl-2,7a-dihydro-1H-indazole (CID 118281576) is 3-methyl-2,7a-dihydro-1H-indazole.
What is the SMILES notation for 3-methyl-2,7a-dihydro-1H-indazole?
The canonical SMILES for 3-methyl-2,7a-dihydro-1H-indazole is CC1=C2C=CC=CC2NN1.
What is the InChIKey of 3-methyl-2,7a-dihydro-1H-indazole?
The InChIKey is SQGGYZIHCWPFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-7-4-2-3-5-8(7)10-9-6/h2-5,8-10H,1H3.
What are the key properties of 3-methyl-2,7a-dihydro-1H-indazole?
3-methyl-2,7a-dihydro-1H-indazole has a molecular weight of 134.18 g/mol, XLogP of 0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,7a-dihydro-1H-indazole is sourced from PubChem (CID 118281576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).