About 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine
2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine (PubChem CID 118281579) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine |
| PubChem CID | 118281579 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine |
| SMILES | C/C=C/C1=NC(C)NC(C)=C1 |
| InChI | InChI=1S/C9H14N2/c1-4-5-9-6-7(2)10-8(3)11-9/h4-6,8,10H,1-3H3/b5-4+ |
| InChIKey | NNGKGWOBRFCFDE-SNAWJCMRSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine?
The IUPAC name of 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine (CID 118281579) is 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine.
What is the SMILES notation for 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine?
The canonical SMILES for 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine is C/C=C/C1=NC(C)NC(C)=C1.
What is the InChIKey of 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine?
The InChIKey is NNGKGWOBRFCFDE-SNAWJCMRSA-N. The full InChI is InChI=1S/C9H14N2/c1-4-5-9-6-7(2)10-8(3)11-9/h4-6,8,10H,1-3H3/b5-4+.
What are the key properties of 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine?
2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine has a molecular weight of 150.22 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-[(E)-prop-1-enyl]-1,2-dihydropyrimidine is sourced from PubChem (CID 118281579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).