About 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine
6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine (PubChem CID 118281581) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine |
| PubChem CID | 118281581 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine |
| SMILES | CCCCCC#CC1=CC(C)N=C(C)N1 |
| InChI | InChI=1S/C13H20N2/c1-4-5-6-7-8-9-13-10-11(2)14-12(3)15-13/h10-11H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | SFBHVRNTTWPWMX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine?
The IUPAC name of 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine (CID 118281581) is 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine.
What is the SMILES notation for 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine?
The canonical SMILES for 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine is CCCCCC#CC1=CC(C)N=C(C)N1.
What is the InChIKey of 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine?
The InChIKey is SFBHVRNTTWPWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-4-5-6-7-8-9-13-10-11(2)14-12(3)15-13/h10-11H,4-7H2,1-3H3,(H,14,15).
What are the key properties of 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine?
6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine has a molecular weight of 204.32 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hept-1-ynyl-2,4-dimethyl-1,4-dihydropyrimidine is sourced from PubChem (CID 118281581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).