C13H17NO — CID 118281628
2-methyl-3,4,4a,6,7,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-one (PubChem CID 118281628) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-methyl-3,4,4a,6,7,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-one.
| Compound Name | 2-methyl-3,4,4a,6,7,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 118281628 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-methyl-3,4,4a,6,7,9b-hexahydro-1H-indeno[1,2-c]pyridin-5-one |
| SMILES | CN1CCC2C(=O)C3=C(C=CCC3)C2C1 |
| InChI | InChI=1S/C13H17NO/c1-14-7-6-11-12(8-14)9-4-2-3-5-10(9)13(11)15/h2,4,11-12H,3,5-8H2,1H3 |
| InChIKey | SBRBWHYZPJZIGD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |