About [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol
[(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol (PubChem CID 118281653) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol.
Molecular Properties
| Compound Name | [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol |
| PubChem CID | 118281653 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol |
| SMILES | COC12C=CC=C(CC[C@@H]1CO)C2 |
| InChI | InChI=1S/C11H16O2/c1-13-11-6-2-3-9(7-11)4-5-10(11)8-12/h2-3,6,10,12H,4-5,7-8H2,1H3/t10-,11?/m1/s1 |
| InChIKey | FDINFUNVIPJNOL-NFJWQWPMSA-N |
| XLogP | 1.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol?
The IUPAC name of [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol (CID 118281653) is [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol.
What is the SMILES notation for [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol?
The canonical SMILES for [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol is COC12C=CC=C(CC[C@@H]1CO)C2.
What is the InChIKey of [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol?
The InChIKey is FDINFUNVIPJNOL-NFJWQWPMSA-N. The full InChI is InChI=1S/C11H16O2/c1-13-11-6-2-3-9(7-11)4-5-10(11)8-12/h2-3,6,10,12H,4-5,7-8H2,1H3/t10-,11?/m1/s1.
What are the key properties of [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol?
[(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol has a molecular weight of 180.25 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-methoxy-2-bicyclo[3.3.1]nona-5,7-dienyl]methanol is sourced from PubChem (CID 118281653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).