C18H22FN5OS — CID 118281731
2-amino-6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(4-methylthiophen-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one (PubChem CID 118281731) has the molecular formula C18H22FN5OS and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-amino-6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(4-methylthiophen-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 2-amino-6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(4-methylthiophen-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 118281731 |
| Molecular Formula | C18H22FN5OS |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-amino-6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(4-methylthiophen-2-yl)-1H-pyrrolo[3,4-c]pyridin-3-one |
| SMILES | Cc1csc(-c2nc(N[C@@H]3CCCC[C@@H]3N)c(F)c3c2C(=O)N(N)C3)c1 |
| InChI | InChI=1S/C18H22FN5OS/c1-9-6-13(26-8-9)16-14-10(7-24(21)18(14)25)15(19)17(23-16)22-12-5-3-2-4-11(12)20/h6,8,11-12H,2-5,7,20-21H2,1H3,(H,22,23)/t11-,12+/m0/s1 |
| InChIKey | UNSPDIILUMTGGG-NWDGAFQWSA-N |
| XLogP | 2.77 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|