About 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole
3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole (PubChem CID 118281783) has the molecular formula C18H29NS
and a molecular weight of 291.50 g/mol. Its IUPAC name is 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 118281783 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole |
| SMILES | CCCCCCc1ccc([C@H](C)C2CC(C)=NC2C)s1 |
| InChI | InChI=1S/C18H29NS/c1-5-6-7-8-9-16-10-11-18(20-16)14(3)17-12-13(2)19-15(17)4/h10-11,14-15,17H,5-9,12H2,1-4H3/t14-,15?,17?/m1/s1 |
| InChIKey | UGNZHGXLYIYFNR-HPUBIQBYSA-N |
| XLogP | 5.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole (CID 118281783) is 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole is CCCCCCc1ccc([C@H](C)C2CC(C)=NC2C)s1.
What is the InChIKey of 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole?
The InChIKey is UGNZHGXLYIYFNR-HPUBIQBYSA-N. The full InChI is InChI=1S/C18H29NS/c1-5-6-7-8-9-16-10-11-18(20-16)14(3)17-12-13(2)19-15(17)4/h10-11,14-15,17H,5-9,12H2,1-4H3/t14-,15?,17?/m1/s1.
What are the key properties of 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole?
3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole has a molecular weight of 291.50 g/mol, XLogP of 5.84, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1-(5-hexylthiophen-2-yl)ethyl]-2,5-dimethyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 118281783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).