C19H26N2O4S — CID 118281802
[(4aR,7aS)-7a-(5-amino-2-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl] tert-butyl carbonate (PubChem CID 118281802) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is [(4aR,7aS)-7a-(5-amino-2-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl] tert-butyl carbonate.
| Compound Name | [(4aR,7aS)-7a-(5-amino-2-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 118281802 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(4aR,7aS)-7a-(5-amino-2-methoxyphenyl)-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl] tert-butyl carbonate |
| SMILES | COc1ccc(N)cc1[C@]12CCC[C@H]1CSC(OC(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C19H26N2O4S/c1-18(2,3)25-17(22)24-16-21-19(9-5-6-12(19)11-26-16)14-10-13(20)7-8-15(14)23-4/h7-8,10,12H,5-6,9,11,20H2,1-4H3/t12-,19-/m0/s1 |
| InChIKey | FMJIHQBARGSMJS-BUXKBTBVSA-N |
| XLogP | 4.33 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|