C13H16FNO — CID 118281804
(3aS,6S,6aS)-6a-(2-fluorophenyl)-6-methyl-1,2,3,3a,4,6-hexahydrofuro[3,4-b]pyrrole (PubChem CID 118281804) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is (3aS,6S,6aS)-6a-(2-fluorophenyl)-6-methyl-1,2,3,3a,4,6-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3aS,6S,6aS)-6a-(2-fluorophenyl)-6-methyl-1,2,3,3a,4,6-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 118281804 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3aS,6S,6aS)-6a-(2-fluorophenyl)-6-methyl-1,2,3,3a,4,6-hexahydrofuro[3,4-b]pyrrole |
| SMILES | C[C@@H]1OC[C@H]2CCN[C@]21c1ccccc1F |
| InChI | InChI=1S/C13H16FNO/c1-9-13(10(8-16-9)6-7-15-13)11-4-2-3-5-12(11)14/h2-5,9-10,15H,6-8H2,1H3/t9-,10+,13-/m0/s1 |
| InChIKey | ZTELONJRBINOKD-CWSCBRNRSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |