C33H60O6Si2 — CID 11828183
(1R,2R,3S,7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-en-5-one (PubChem CID 11828183) has the molecular formula C33H60O6Si2 and a molecular weight of 609.01 g/mol. Its IUPAC name is (1R,2R,3S,7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-en-5-one.
| Compound Name | (1R,2R,3S,7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-en-5-one |
|---|---|
| PubChem CID | 11828183 |
| Molecular Formula | C33H60O6Si2 |
| Molecular Weight | 609.01 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | (1R,2R,3S,7S,8R,10R,13S)-7-but-3-enyl-13-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-8,12,15,15-tetramethyl-10-triethylsilyloxy-4,6-dioxatricyclo[9.3.1.03,8]pentadec-11-en-5-one |
| SMILES | C=CCC[C@@H]1OC(=O)O[C@@H]2[C@H](O)[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=C([C@H](O[Si](CC)(CC)CC)C[C@]12C)C3(C)C |
| InChI | InChI=1S/C33H60O6Si2/c1-14-18-19-26-33(11)21-25(39-41(15-2,16-3)17-4)27-22(5)24(38-40(12,13)31(6,7)8)20-23(32(27,9)10)28(34)29(33)37-30(35)36-26/h14,23-26,28-29,34H,1,15-21H2,2-13H3/t23-,24-,25+,26-,28+,29+,33+/m0/s1 |
| InChIKey | BCHAWEUFPQCFRK-FGBFYDKRSA-N |
| XLogP | 8.77 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.01 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|