C13H16FNO — CID 118281847
(3aR,5S,6aS)-6a-(2-fluorophenyl)-5-methyl-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole (PubChem CID 118281847) has the molecular formula C13H16FNO and a molecular weight of 221.27 g/mol. Its IUPAC name is (3aR,5S,6aS)-6a-(2-fluorophenyl)-5-methyl-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole.
| Compound Name | (3aR,5S,6aS)-6a-(2-fluorophenyl)-5-methyl-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 118281847 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3aR,5S,6aS)-6a-(2-fluorophenyl)-5-methyl-1,3,3a,4,5,6-hexahydrocyclopenta[c][1,2]oxazole |
| SMILES | C[C@H]1C[C@H]2CON[C@@]2(c2ccccc2F)C1 |
| InChI | InChI=1S/C13H16FNO/c1-9-6-10-8-16-15-13(10,7-9)11-4-2-3-5-12(11)14/h2-5,9-10,15H,6-8H2,1H3/t9-,10-,13-/m0/s1 |
| InChIKey | OPCJNGPFSCZSHS-KWBADKCTSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |