C20H17F2N3S — CID 118281857
(4aR)-7a-[2-fluoro-5-[2-(2-fluoro-3-pyridinyl)ethynyl]phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine (PubChem CID 118281857) has the molecular formula C20H17F2N3S and a molecular weight of 369.44 g/mol. Its IUPAC name is (4aR)-7a-[2-fluoro-5-[2-(2-fluoro-3-pyridinyl)ethynyl]phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | (4aR)-7a-[2-fluoro-5-[2-(2-fluoro-3-pyridinyl)ethynyl]phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 118281857 |
| Molecular Formula | C20H17F2N3S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (4aR)-7a-[2-fluoro-5-[2-(2-fluoro-3-pyridinyl)ethynyl]phenyl]-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-amine |
| SMILES | NC1=NC2(c3cc(C#Cc4cccnc4F)ccc3F)CCC[C@H]2CS1 |
| InChI | InChI=1S/C20H17F2N3S/c21-17-8-6-13(5-7-14-3-2-10-24-18(14)22)11-16(17)20-9-1-4-15(20)12-26-19(23)25-20/h2-3,6,8,10-11,15H,1,4,9,12H2,(H2,23,25)/t15-,20?/m0/s1 |
| InChIKey | FOGOWCVWSCUFSN-OOJLDXBWSA-N |
| XLogP | 3.82 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|