About (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine
(2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine (PubChem CID 118281865) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine.
Molecular Properties
| Compound Name | (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine |
| PubChem CID | 118281865 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine |
| SMILES | [H]/N=C/C(=C\N=C)C(C)(C)C |
| InChI | InChI=1S/C8H14N2/c1-8(2,3)7(5-9)6-10-4/h5-6,9H,4H2,1-3H3/b7-6+,9-5+ |
| InChIKey | UUAVPPYYHTYEIM-CQCRHSALSA-N |
| XLogP | 2.27 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine?
The IUPAC name of (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine (CID 118281865) is (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine.
What is the SMILES notation for (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine?
The canonical SMILES for (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine is [H]/N=C/C(=C\N=C)C(C)(C)C.
What is the InChIKey of (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine?
The InChIKey is UUAVPPYYHTYEIM-CQCRHSALSA-N. The full InChI is InChI=1S/C8H14N2/c1-8(2,3)7(5-9)6-10-4/h5-6,9H,4H2,1-3H3/b7-6+,9-5+.
What are the key properties of (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine?
(2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine has a molecular weight of 138.21 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,3-dimethyl-2-[(methylideneamino)methylidene]butan-1-imine is sourced from PubChem (CID 118281865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).