C12H18O6 — CID 118281909
[(3aR,4R,5R,6aS)-4-(dimethoxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 118281909) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(dimethoxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(dimethoxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 118281909 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(dimethoxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | COC(OC)[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H18O6/c1-6(13)17-9-5-8-7(4-10(14)18-8)11(9)12(15-2)16-3/h7-9,11-12H,4-5H2,1-3H3/t7-,8-,9+,11+/m0/s1 |
| InChIKey | VZGWDZCLSIRMIA-WYOJIJJFSA-N |
| XLogP | 0.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|