About N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine
N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine (PubChem CID 118282096) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine |
| PubChem CID | 118282096 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine |
| SMILES | COCCCN1C=C(CNC2CC2)COC1 |
| InChI | InChI=1S/C12H22N2O2/c1-15-6-2-5-14-8-11(9-16-10-14)7-13-12-3-4-12/h8,12-13H,2-7,9-10H2,1H3 |
| InChIKey | XUVMRDBFCUSWAK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine?
The IUPAC name of N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine (CID 118282096) is N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine?
The canonical SMILES for N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine is COCCCN1C=C(CNC2CC2)COC1.
What is the InChIKey of N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine?
The InChIKey is XUVMRDBFCUSWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-15-6-2-5-14-8-11(9-16-10-14)7-13-12-3-4-12/h8,12-13H,2-7,9-10H2,1H3.
What are the key properties of N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine?
N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine has a molecular weight of 226.32 g/mol, XLogP of 0.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(3-methoxypropyl)-2,6-dihydro-1,3-oxazin-5-yl]methyl]cyclopropanamine is sourced from PubChem (CID 118282096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).