C58H40N4 — CID 118282246
(2E,4E)-3-[3-[9-(2,6-diphenyl-4-pyridinyl)carbazol-3-yl]carbazol-9-yl]-1,5-diphenylpenta-2,4-dien-1-imine (PubChem CID 118282246) has the molecular formula C58H40N4 and a molecular weight of 792.99 g/mol. Its IUPAC name is (2E,4E)-3-[3-[9-(2,6-diphenyl-4-pyridinyl)carbazol-3-yl]carbazol-9-yl]-1,5-diphenylpenta-2,4-dien-1-imine.
| Compound Name | (2E,4E)-3-[3-[9-(2,6-diphenyl-4-pyridinyl)carbazol-3-yl]carbazol-9-yl]-1,5-diphenylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 118282246 |
| Molecular Formula | C58H40N4 |
| Molecular Weight | 792.99 g/mol |
| Exact Mass | 792.33 |
| IUPAC Name | (2E,4E)-3-[3-[9-(2,6-diphenyl-4-pyridinyl)carbazol-3-yl]carbazol-9-yl]-1,5-diphenylpenta-2,4-dien-1-imine |
| SMILES | [H]/N=C(/C=C(\C=C\c1ccccc1)n1c2ccccc2c2cc(-c3ccc4c(c3)c3ccccc3n4-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)ccc21)c1ccccc1 |
| InChI | InChI=1S/C58H40N4/c59-52(41-19-7-2-8-20-41)37-46(32-29-40-17-5-1-6-18-40)61-55-27-15-13-25-48(55)50-35-44(30-33-57(50)61)45-31-34-58-51(36-45)49-26-14-16-28-56(49)62(58)47-38-53(42-21-9-3-10-22-42)60-54(39-47)43-23-11-4-12-24-43/h1-39,59H/b32-29+,46-37+,59-52- |
| InChIKey | MYNIKAGVBAKWOX-TWLCJLSMSA-N |
| XLogP | 14.91 |
| TPSA | 46.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.99 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|