C28H37F3N4O3S — CID 118282334
(7S)-N-[(4-ethylsulfonylphenyl)methyl]-7-propan-2-yl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide (PubChem CID 118282334) has the molecular formula C28H37F3N4O3S and a molecular weight of 566.69 g/mol. Its IUPAC name is (7S)-N-[(4-ethylsulfonylphenyl)methyl]-7-propan-2-yl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | (7S)-N-[(4-ethylsulfonylphenyl)methyl]-7-propan-2-yl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118282334 |
| Molecular Formula | C28H37F3N4O3S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | (7S)-N-[(4-ethylsulfonylphenyl)methyl]-7-propan-2-yl-6-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-5,7-dihydropyrrolo[3,4-b]pyridine-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2cnc3c(c2)CN(CC2CCN(CC(F)(F)F)CC2)[C@H]3C(C)C)cc1 |
| InChI | InChI=1S/C28H37F3N4O3S/c1-4-39(37,38)24-7-5-20(6-8-24)14-33-27(36)22-13-23-17-35(26(19(2)3)25(23)32-15-22)16-21-9-11-34(12-10-21)18-28(29,30)31/h5-8,13,15,19,21,26H,4,9-12,14,16-18H2,1-3H3,(H,33,36)/t26-/m0/s1 |
| InChIKey | WBOGYCSSMIOPHL-SANMLTNESA-N |
| XLogP | 4.59 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |