C36H34O15 — CID 118282704
[(2R,3R)-5-acetyloxy-7-methyl-2-(3,4,5-triacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-diacetyloxy-4-methylbenzoate (PubChem CID 118282704) has the molecular formula C36H34O15 and a molecular weight of 706.65 g/mol. Its IUPAC name is [(2R,3R)-5-acetyloxy-7-methyl-2-(3,4,5-triacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-diacetyloxy-4-methylbenzoate.
| Compound Name | [(2R,3R)-5-acetyloxy-7-methyl-2-(3,4,5-triacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-diacetyloxy-4-methylbenzoate |
|---|---|
| PubChem CID | 118282704 |
| Molecular Formula | C36H34O15 |
| Molecular Weight | 706.65 g/mol |
| Exact Mass | 706.19 |
| IUPAC Name | [(2R,3R)-5-acetyloxy-7-methyl-2-(3,4,5-triacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-diacetyloxy-4-methylbenzoate |
| SMILES | CC(=O)Oc1cc(C(=O)O[C@@H]2Cc3c(OC(C)=O)cc(C)cc3O[C@@H]2c2cc(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c2)cc(OC(C)=O)c1C |
| InChI | InChI=1S/C36H34O15/c1-16-9-29(46-20(5)39)26-15-33(51-36(43)25-13-27(44-18(3)37)17(2)28(14-25)45-19(4)38)34(50-30(26)10-16)24-11-31(47-21(6)40)35(49-23(8)42)32(12-24)48-22(7)41/h9-14,33-34H,15H2,1-8H3/t33-,34-/m1/s1 |
| InChIKey | KKXUJAYVFZZUKP-KKLWWLSJSA-N |
| XLogP | 4.76 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|