About 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole
2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole (PubChem CID 118282836) has the molecular formula C24H32FNO2
and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole |
| PubChem CID | 118282836 |
| Molecular Formula | C24H32FNO2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole |
| SMILES | CC(C)Oc1ccc(CC[C@@H](C)N2Cc3ccc(F)cc3C2)cc1OC(C)C |
| InChI | InChI=1S/C24H32FNO2/c1-16(2)27-23-11-8-19(12-24(23)28-17(3)4)7-6-18(5)26-14-20-9-10-22(25)13-21(20)15-26/h8-13,16-18H,6-7,14-15H2,1-5H3/t18-/m1/s1 |
| InChIKey | CVCVHLAGPYEAKC-GOSISDBHSA-N |
| XLogP | 5.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole?
The IUPAC name of 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole (CID 118282836) is 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole.
What is the SMILES notation for 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole?
The canonical SMILES for 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole is CC(C)Oc1ccc(CC[C@@H](C)N2Cc3ccc(F)cc3C2)cc1OC(C)C.
What is the InChIKey of 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole?
The InChIKey is CVCVHLAGPYEAKC-GOSISDBHSA-N. The full InChI is InChI=1S/C24H32FNO2/c1-16(2)27-23-11-8-19(12-24(23)28-17(3)4)7-6-18(5)26-14-20-9-10-22(25)13-21(20)15-26/h8-13,16-18H,6-7,14-15H2,1-5H3/t18-/m1/s1.
What are the key properties of 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole?
2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole has a molecular weight of 385.52 g/mol, XLogP of 5.74, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-4-[3,4-di(propan-2-yloxy)phenyl]butan-2-yl]-5-fluoro-1,3-dihydroisoindole is sourced from PubChem (CID 118282836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).