About 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol
4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol (PubChem CID 118282837) has the molecular formula C23H30FNO2
and a molecular weight of 371.50 g/mol. Its IUPAC name is 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol.
Molecular Properties
| Compound Name | 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol |
| PubChem CID | 118282837 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol |
| SMILES | CC(C)(C)Oc1cc(CCC(C)(C)N2Cc3cccc(F)c3C2)ccc1O |
| InChI | InChI=1S/C23H30FNO2/c1-22(2,3)27-21-13-16(9-10-20(21)26)11-12-23(4,5)25-14-17-7-6-8-19(24)18(17)15-25/h6-10,13,26H,11-12,14-15H2,1-5H3 |
| InChIKey | DOCRCBAANQJZLH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol?
The IUPAC name of 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol (CID 118282837) is 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol.
What is the SMILES notation for 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol?
The canonical SMILES for 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol is CC(C)(C)Oc1cc(CCC(C)(C)N2Cc3cccc(F)c3C2)ccc1O.
What is the InChIKey of 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol?
The InChIKey is DOCRCBAANQJZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30FNO2/c1-22(2,3)27-21-13-16(9-10-20(21)26)11-12-23(4,5)25-14-17-7-6-8-19(24)18(17)15-25/h6-10,13,26H,11-12,14-15H2,1-5H3.
What are the key properties of 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol?
4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol has a molecular weight of 371.50 g/mol, XLogP of 5.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-fluoro-1,3-dihydroisoindol-2-yl)-3-methylbutyl]-2-[(2-methylpropan-2-yl)oxy]phenol is sourced from PubChem (CID 118282837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).