About 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole
2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole (PubChem CID 118282881) has the molecular formula C25H34FNO2
and a molecular weight of 399.55 g/mol. Its IUPAC name is 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole |
| PubChem CID | 118282881 |
| Molecular Formula | C25H34FNO2 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole |
| SMILES | CC(C)Oc1ccc(CCC(C)(C)N2Cc3ccc(F)cc3C2)cc1OC(C)C |
| InChI | InChI=1S/C25H34FNO2/c1-17(2)28-23-10-7-19(13-24(23)29-18(3)4)11-12-25(5,6)27-15-20-8-9-22(26)14-21(20)16-27/h7-10,13-14,17-18H,11-12,15-16H2,1-6H3 |
| InChIKey | LZYHBBIARMIKJV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole?
The IUPAC name of 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole (CID 118282881) is 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole.
What is the SMILES notation for 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole?
The canonical SMILES for 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole is CC(C)Oc1ccc(CCC(C)(C)N2Cc3ccc(F)cc3C2)cc1OC(C)C.
What is the InChIKey of 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole?
The InChIKey is LZYHBBIARMIKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34FNO2/c1-17(2)28-23-10-7-19(13-24(23)29-18(3)4)11-12-25(5,6)27-15-20-8-9-22(26)14-21(20)16-27/h7-10,13-14,17-18H,11-12,15-16H2,1-6H3.
What are the key properties of 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole?
2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole has a molecular weight of 399.55 g/mol, XLogP of 6.13, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3,4-di(propan-2-yloxy)phenyl]-2-methylbutan-2-yl]-5-fluoro-1,3-dihydroisoindole is sourced from PubChem (CID 118282881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).