About 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol
4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol (PubChem CID 118282956) has the molecular formula C19H22FNO2
and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol |
| PubChem CID | 118282956 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol |
| SMILES | COc1cc(CC[C@@H](C)N2Cc3cccc(F)c3C2)ccc1O |
| InChI | InChI=1S/C19H22FNO2/c1-13(6-7-14-8-9-18(22)19(10-14)23-2)21-11-15-4-3-5-17(20)16(15)12-21/h3-5,8-10,13,22H,6-7,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | YYNYULNQESTNGR-CYBMUJFWSA-N |
| XLogP | 3.88 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol?
The IUPAC name of 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol (CID 118282956) is 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol.
What is the SMILES notation for 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol?
The canonical SMILES for 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol is COc1cc(CC[C@@H](C)N2Cc3cccc(F)c3C2)ccc1O.
What is the InChIKey of 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol?
The InChIKey is YYNYULNQESTNGR-CYBMUJFWSA-N. The full InChI is InChI=1S/C19H22FNO2/c1-13(6-7-14-8-9-18(22)19(10-14)23-2)21-11-15-4-3-5-17(20)16(15)12-21/h3-5,8-10,13,22H,6-7,11-12H2,1-2H3/t13-/m1/s1.
What are the key properties of 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol?
4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol has a molecular weight of 315.39 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R)-3-(4-fluoro-1,3-dihydroisoindol-2-yl)butyl]-2-methoxyphenol is sourced from PubChem (CID 118282956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).