C26H35N5O2 — CID 118283205
ethyl 8-(2-aminopyrimidin-5-yl)-5-octyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate (PubChem CID 118283205) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is ethyl 8-(2-aminopyrimidin-5-yl)-5-octyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate.
| Compound Name | ethyl 8-(2-aminopyrimidin-5-yl)-5-octyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 118283205 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | ethyl 8-(2-aminopyrimidin-5-yl)-5-octyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxylate |
| SMILES | CCCCCCCCn1c2c(c3cc(-c4cnc(N)nc4)ccc31)CN(C(=O)OCC)CC2 |
| InChI | InChI=1S/C26H35N5O2/c1-3-5-6-7-8-9-13-31-23-11-10-19(20-16-28-25(27)29-17-20)15-21(23)22-18-30(14-12-24(22)31)26(32)33-4-2/h10-11,15-17H,3-9,12-14,18H2,1-2H3,(H2,27,28,29) |
| InChIKey | AQXXKVAFNIDONF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|