C22H28O2 — CID 118284086
2,3,5-trimethyl-6-trideca-5,10-diynylcyclohexa-2,5-diene-1,4-dione (PubChem CID 118284086) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-trideca-5,10-diynylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trimethyl-6-trideca-5,10-diynylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118284086 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2,3,5-trimethyl-6-trideca-5,10-diynylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCC#CCCCC#CCCCCC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C22H28O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-20-19(4)21(23)17(2)18(3)22(20)24/h5,8-10,13-16H2,1-4H3 |
| InChIKey | PELWLJQIZNFTHK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|