C42H54O4S — CID 11828444
(2S)-2-[(2Z,4R,5E,8R)-3-(benzenesulfonyl)-4,8,12-trimethyltrideca-2,5,11-trienyl]-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromene (PubChem CID 11828444) has the molecular formula C42H54O4S and a molecular weight of 654.96 g/mol. Its IUPAC name is (2S)-2-[(2Z,4R,5E,8R)-3-(benzenesulfonyl)-4,8,12-trimethyltrideca-2,5,11-trienyl]-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromene.
| Compound Name | (2S)-2-[(2Z,4R,5E,8R)-3-(benzenesulfonyl)-4,8,12-trimethyltrideca-2,5,11-trienyl]-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromene |
|---|---|
| PubChem CID | 11828444 |
| Molecular Formula | C42H54O4S |
| Molecular Weight | 654.96 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | (2S)-2-[(2Z,4R,5E,8R)-3-(benzenesulfonyl)-4,8,12-trimethyltrideca-2,5,11-trienyl]-2,5,7,8-tetramethyl-6-phenylmethoxy-3,4-dihydrochromene |
| SMILES | CC(C)=CCC[C@@H](C)C/C=C/[C@@H](C)/C(=C/C[C@]1(C)CCc2c(C)c(OCc3ccccc3)c(C)c(C)c2O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C42H54O4S/c1-30(2)17-15-18-31(3)19-16-20-32(4)39(47(43,44)37-23-13-10-14-24-37)26-28-42(8)27-25-38-35(7)40(33(5)34(6)41(38)46-42)45-29-36-21-11-9-12-22-36/h9-14,16-17,20-24,26,31-32H,15,18-19,25,27-29H2,1-8H3/b20-16+,39-26-/t31-,32-,42+/m1/s1 |
| InChIKey | QUWNYGZKPSGWDL-UVJCMPPZSA-N |
| XLogP | 10.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.96 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|