C18H31N3O — CID 118284563
(4R,5R,6S)-12-tert-butyl-5-[(2-methylpropan-2-yl)oxymethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene (PubChem CID 118284563) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is (4R,5R,6S)-12-tert-butyl-5-[(2-methylpropan-2-yl)oxymethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene.
| Compound Name | (4R,5R,6S)-12-tert-butyl-5-[(2-methylpropan-2-yl)oxymethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
|---|---|
| PubChem CID | 118284563 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | (4R,5R,6S)-12-tert-butyl-5-[(2-methylpropan-2-yl)oxymethyl]-10,11,12-triazatricyclo[7.3.0.04,6]dodeca-1(9),10-diene |
| SMILES | CC(C)(C)OC[C@@H]1[C@@H]2CCc3c(nnn3C(C)(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C18H31N3O/c1-17(2,3)21-16-10-8-13-12(7-9-15(16)19-20-21)14(13)11-22-18(4,5)6/h12-14H,7-11H2,1-6H3/t12-,13+,14-/m0/s1 |
| InChIKey | SSOQMWKSFYGENC-MJBXVCDLSA-N |
| XLogP | 3.59 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |