C30H16O3 — CID 118284801
(1S)-1-[(4S,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol (PubChem CID 118284801) has the molecular formula C30H16O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is (1S)-1-[(4S,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol.
| Compound Name | (1S)-1-[(4S,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 118284801 |
| Molecular Formula | C30H16O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (1S)-1-[(4S,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]propan-1-ol |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C[C@H]1OC(C)(C)O[C@H]1[C@@H](O)CC |
| InChI | InChI=1S/C30H16O3/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28-29(27(31)6-2)33-30(3,4)32-28/h1,27-29,31H,6H2,2-4H3/t27-,28+,29-/m0/s1 |
| InChIKey | HNUKKONOZSNIHR-NHKHRBQYSA-N |
| XLogP | 0.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|