C24H24N6O3S — CID 118284875
N-[3-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide (PubChem CID 118284875) has the molecular formula C24H24N6O3S and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[3-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide.
| Compound Name | N-[3-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 118284875 |
| Molecular Formula | C24H24N6O3S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-[3-(3-methoxypropylcarbamoyl)phenyl]-3-methyl-5-(quinoxalin-2-ylamino)-1,2-thiazole-4-carboxamide |
| SMILES | COCCCNC(=O)c1cccc(NC(=O)c2c(C)nsc2Nc2cnc3ccccc3n2)c1 |
| InChI | InChI=1S/C24H24N6O3S/c1-15-21(24(34-30-15)29-20-14-26-18-9-3-4-10-19(18)28-20)23(32)27-17-8-5-7-16(13-17)22(31)25-11-6-12-33-2/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H,25,31)(H,27,32)(H,28,29) |
| InChIKey | AOQPVFHINKBRIX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 118.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|