C26H18F3N3O4 — CID 118285513
4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4,6-difluoro-1H-benzimidazol-5-yl]phenyl]-3-fluorobenzonitrile (PubChem CID 118285513) has the molecular formula C26H18F3N3O4 and a molecular weight of 493.44 g/mol. Its IUPAC name is 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4,6-difluoro-1H-benzimidazol-5-yl]phenyl]-3-fluorobenzonitrile.
| Compound Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4,6-difluoro-1H-benzimidazol-5-yl]phenyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 118285513 |
| Molecular Formula | C26H18F3N3O4 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4,6-difluoro-1H-benzimidazol-5-yl]phenyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3c(F)cc4[nH]c(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)nc4c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C26H18F3N3O4/c27-16-7-12(9-30)1-6-15(16)13-2-4-14(5-3-13)21-17(28)8-18-23(22(21)29)32-26(31-18)36-20-11-35-24-19(33)10-34-25(20)24/h1-8,19-20,24-25,33H,10-11H2,(H,31,32)/t19-,20-,24-,25-/m1/s1 |
| InChIKey | BCDKUICBAODDJH-GQUJEBGOSA-N |
| XLogP | 4.09 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |